C22H23NO7 — CID 70530502
but-2-enedioic acid;6,7-dimethoxyspiro[2,3-dihydro-1H-isoquinoline-4,2'-3H-1-benzofuran] (PubChem CID 70530502) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is but-2-enedioic acid;6,7-dimethoxyspiro[2,3-dihydro-1H-isoquinoline-4,2'-3H-1-benzofuran].
| Compound Name | but-2-enedioic acid;6,7-dimethoxyspiro[2,3-dihydro-1H-isoquinoline-4,2'-3H-1-benzofuran] |
|---|---|
| PubChem CID | 70530502 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | but-2-enedioic acid;6,7-dimethoxyspiro[2,3-dihydro-1H-isoquinoline-4,2'-3H-1-benzofuran] |
| SMILES | COc1cc2c(cc1OC)C1(CNC2)Cc2ccccc2O1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H19NO3.C4H4O4/c1-20-16-7-13-10-19-11-18(14(13)8-17(16)21-2)9-12-5-3-4-6-15(12)22-18;5-3(6)1-2-4(7)8/h3-8,19H,9-11H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HYWALXREIUZTRZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|