C41H62N2O4 — CID 70530835
2-benzyl-2-[bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-phenylmethyl]propanedioic acid (PubChem CID 70530835) has the molecular formula C41H62N2O4 and a molecular weight of 646.96 g/mol. Its IUPAC name is 2-benzyl-2-[bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-phenylmethyl]propanedioic acid.
| Compound Name | 2-benzyl-2-[bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-phenylmethyl]propanedioic acid |
|---|---|
| PubChem CID | 70530835 |
| Molecular Formula | C41H62N2O4 |
| Molecular Weight | 646.96 g/mol |
| Exact Mass | 646.47 |
| IUPAC Name | 2-benzyl-2-[bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-phenylmethyl]propanedioic acid |
| SMILES | CCC1(C)CC(C(c2ccccc2)(C2CC(C)(CC)NC(C)(CC)C2C)C(Cc2ccccc2)(C(=O)O)C(=O)O)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C41H62N2O4/c1-11-36(7)26-32(28(5)38(9,13-3)42-36)41(31-23-19-16-20-24-31,33-27-37(8,12-2)43-39(10,14-4)29(33)6)40(34(44)45,35(46)47)25-30-21-17-15-18-22-30/h15-24,28-29,32-33,42-43H,11-14,25-27H2,1-10H3,(H,44,45)(H,46,47) |
| InChIKey | UURJJTYLORLIGU-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.96 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|