C12H17N3O2S — CID 70531071
6-(hex-3-enylamino)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 70531071) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-(hex-3-enylamino)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 6-(hex-3-enylamino)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 70531071 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-(hex-3-enylamino)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | CCC=CCCNC1C(=O)N=C2SCCN2C1=O |
| InChI | InChI=1S/C12H17N3O2S/c1-2-3-4-5-6-13-9-10(16)14-12-15(11(9)17)7-8-18-12/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | WLDXEHBKAUTEIH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|