C16H27N — CID 70531114
2-(3-methylbutan-2-yl)-1-azacyclododeca-4,8,12-triene (PubChem CID 70531114) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-(3-methylbutan-2-yl)-1-azacyclododeca-4,8,12-triene.
| Compound Name | 2-(3-methylbutan-2-yl)-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 70531114 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-(3-methylbutan-2-yl)-1-azacyclododeca-4,8,12-triene |
| SMILES | CC(C)C(C)C1CC=CCCC=CCC/C=N/1 |
| InChI | InChI=1S/C16H27N/c1-14(2)15(3)16-12-10-8-6-4-5-7-9-11-13-17-16/h5,7-8,10,13-16H,4,6,9,11-12H2,1-3H3/b7-5?,10-8?,17-13+ |
| InChIKey | SSUWUQYXOKORLC-XFQHGKMDSA-N |
| XLogP | 4.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|