C10H14N2O4 — CID 7053157
(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid (PubChem CID 7053157) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid.
| Compound Name | (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid |
|---|---|
| PubChem CID | 7053157 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid |
| SMILES | C[C@@H](CC(=O)O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-6(4-8(13)14)7-5-11(2)10(16)12(3)9(7)15/h5-6H,4H2,1-3H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | XIDXCFOHGHYXFN-LURJTMIESA-N |
| XLogP | -0.34 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |