(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid

C10H14N2O4 — CID 7053157

IUPAC(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid
SMILESC[C@@H](CC(=O)O)c1cn(C)c(=O)n(C)c1=O
InChIInChI=1S/C10H14N2O4/c1-6(4-8(13)14)7-5-11(2)10(16)12(3)9(7)15/h5-6H,4H2,1-3H3,(H,13,14)/t6-/m0/s1
InChIKeyXIDXCFOHGHYXFN-LURJTMIESA-N
MW226.23 g/mol
LogP-0.34
Rot. Bonds3

About (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid

(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid (PubChem CID 7053157) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid.

Molecular Properties

Compound Name(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid
PubChem CID7053157
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid
SMILESC[C@@H](CC(=O)O)c1cn(C)c(=O)n(C)c1=O
InChIInChI=1S/C10H14N2O4/c1-6(4-8(13)14)7-5-11(2)10(16)12(3)9(7)15/h5-6H,4H2,1-3H3,(H,13,14)/t6-/m0/s1
InChIKeyXIDXCFOHGHYXFN-LURJTMIESA-N
XLogP-0.34
TPSA81.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 5-0.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid?
The IUPAC name of (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid (CID 7053157) is (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid.
What is the SMILES notation for (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid?
The canonical SMILES for (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid is C[C@@H](CC(=O)O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid?
The InChIKey is XIDXCFOHGHYXFN-LURJTMIESA-N. The full InChI is InChI=1S/C10H14N2O4/c1-6(4-8(13)14)7-5-11(2)10(16)12(3)9(7)15/h5-6H,4H2,1-3H3,(H,13,14)/t6-/m0/s1.
What are the key properties of (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid?
(3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid has a molecular weight of 226.23 g/mol, XLogP of -0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoic acid is sourced from PubChem (CID 7053157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).