About methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate
methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate (PubChem CID 7053167) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate.
Molecular Properties
| Compound Name | methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate |
| PubChem CID | 7053167 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate |
| SMILES | COC(=O)C[C@@H](C)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H16N2O4/c1-7(5-9(14)17-4)8-6-12(2)11(16)13(3)10(8)15/h6-7H,5H2,1-4H3/t7-/m1/s1 |
| InChIKey | AJIWCSBXZXYNFT-SSDOTTSWSA-N |
| XLogP | -0.25 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate?
The IUPAC name of methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate (CID 7053167) is methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate.
What is the SMILES notation for methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate?
The canonical SMILES for methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate is COC(=O)C[C@@H](C)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate?
The InChIKey is AJIWCSBXZXYNFT-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-7(5-9(14)17-4)8-6-12(2)11(16)13(3)10(8)15/h6-7H,5H2,1-4H3/t7-/m1/s1.
What are the key properties of methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate?
methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate has a molecular weight of 240.26 g/mol, XLogP of -0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanoate is sourced from PubChem (CID 7053167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).