C21H39N9 — CID 70531782
N-[4,6-bis[(N-tert-butyl-C-methylcarbonimidoyl)amino]-1,3,5-triazin-2-yl]-N'-tert-butylethanimidamide (PubChem CID 70531782) has the molecular formula C21H39N9 and a molecular weight of 417.61 g/mol. Its IUPAC name is N-[4,6-bis[(N-tert-butyl-C-methylcarbonimidoyl)amino]-1,3,5-triazin-2-yl]-N'-tert-butylethanimidamide.
| Compound Name | N-[4,6-bis[(N-tert-butyl-C-methylcarbonimidoyl)amino]-1,3,5-triazin-2-yl]-N'-tert-butylethanimidamide |
|---|---|
| PubChem CID | 70531782 |
| Molecular Formula | C21H39N9 |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.33 |
| IUPAC Name | N-[4,6-bis[(N-tert-butyl-C-methylcarbonimidoyl)amino]-1,3,5-triazin-2-yl]-N'-tert-butylethanimidamide |
| SMILES | C/C(=N\C(C)(C)C)Nc1nc(N/C(C)=N/C(C)(C)C)nc(N/C(C)=N/C(C)(C)C)n1 |
| InChI | InChI=1S/C21H39N9/c1-13(28-19(4,5)6)22-16-25-17(23-14(2)29-20(7,8)9)27-18(26-16)24-15(3)30-21(10,11)12/h1-12H3,(H3,22,23,24,25,26,27,28,29,30) |
| InChIKey | YBCCWFFSSQUGAO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|