About 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate
4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate (PubChem CID 7053184) has the molecular formula C16H24N2O6
and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate |
| PubChem CID | 7053184 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate |
| SMILES | CCOC(=O)[C@@H](CC(=O)OC(C)(C)C)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H24N2O6/c1-7-23-14(21)10(8-12(19)24-16(2,3)4)11-9-17(5)15(22)18(6)13(11)20/h9-10H,7-8H2,1-6H3/t10-/m0/s1 |
| InChIKey | ZBJNVLOHFVREFE-JTQLQIEISA-N |
| XLogP | 0.46 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate (CID 7053184) is 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate is CCOC(=O)[C@@H](CC(=O)OC(C)(C)C)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate?
The InChIKey is ZBJNVLOHFVREFE-JTQLQIEISA-N. The full InChI is InChI=1S/C16H24N2O6/c1-7-23-14(21)10(8-12(19)24-16(2,3)4)11-9-17(5)15(22)18(6)13(11)20/h9-10H,7-8H2,1-6H3/t10-/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate?
4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate has a molecular weight of 340.38 g/mol, XLogP of 0.46, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-ethyl (2S)-2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)butanedioate is sourced from PubChem (CID 7053184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).