C14H13Cl2NO — CID 70531872
2-[1-(2,4-dichlorophenyl)ethyl]-3-methoxypyridine (PubChem CID 70531872) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethyl]-3-methoxypyridine.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethyl]-3-methoxypyridine |
|---|---|
| PubChem CID | 70531872 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethyl]-3-methoxypyridine |
| SMILES | COc1cccnc1C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO/c1-9(11-6-5-10(15)8-12(11)16)14-13(18-2)4-3-7-17-14/h3-9H,1-2H3 |
| InChIKey | LXXYOGYGWVCZIO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |