C10H9NO3 — CID 705319
4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione (PubChem CID 705319) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 705319 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4,7-dimethyl-6H-pyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1cc2oc(=O)cc(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H9NO3/c1-5-3-8(12)14-7-4-6(2)11-10(13)9(5)7/h3-4H,1-2H3,(H,11,13) |
| InChIKey | TWDXOJOBVIGEOK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |