About 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate
2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate (PubChem CID 70531981) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate |
| PubChem CID | 70531981 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C(=O)OCCOC(=O)C1CCC(C#N)CC1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)14(18)20-9-8-19-13(17)12-6-4-11(10-16)5-7-12/h11-12H,4-9H2,1-3H3 |
| InChIKey | RADSEFJCXGNOJK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate?
The IUPAC name of 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate (CID 70531981) is 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate.
What is the SMILES notation for 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate?
The canonical SMILES for 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate is CC(C)(C)C(=O)OCCOC(=O)C1CCC(C#N)CC1.
What is the InChIKey of 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate?
The InChIKey is RADSEFJCXGNOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-15(2,3)14(18)20-9-8-19-13(17)12-6-4-11(10-16)5-7-12/h11-12H,4-9H2,1-3H3.
What are the key properties of 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate?
2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate has a molecular weight of 281.35 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoyloxy)ethyl 4-cyanocyclohexane-1-carboxylate is sourced from PubChem (CID 70531981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).