About (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene
(2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene (PubChem CID 70532937) has the molecular formula C24H25NO2
and a molecular weight of 359.47 g/mol. Its IUPAC name is (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene.
Molecular Properties
| Compound Name | (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene |
| PubChem CID | 70532937 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.OC(c1cccnc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H15NO.C6H10O/c20-18(15-9-6-12-19-13-15)17-11-5-4-10-16(17)14-7-2-1-3-8-14;1-3-5-7-6-4-2/h1-13,18,20H;3-4H,1-2,5-6H2 |
| InChIKey | BRZMZGGVZXSZEN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene?
The IUPAC name of (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene (CID 70532937) is (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene.
What is the SMILES notation for (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene?
The canonical SMILES for (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene is C=CCOCC=C.OC(c1cccnc1)c1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene?
The InChIKey is BRZMZGGVZXSZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO.C6H10O/c20-18(15-9-6-12-19-13-15)17-11-5-4-10-16(17)14-7-2-1-3-8-14;1-3-5-7-6-4-2/h1-13,18,20H;3-4H,1-2,5-6H2.
What are the key properties of (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene?
(2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene has a molecular weight of 359.47 g/mol, XLogP of 5.21, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl)-pyridin-3-ylmethanol;3-prop-2-enoxyprop-1-ene is sourced from PubChem (CID 70532937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).