About 2,2-diethyl-1,3-dioxocane-4,8-dione
2,2-diethyl-1,3-dioxocane-4,8-dione (PubChem CID 70532987) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2,2-diethyl-1,3-dioxocane-4,8-dione.
Molecular Properties
| Compound Name | 2,2-diethyl-1,3-dioxocane-4,8-dione |
| PubChem CID | 70532987 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2,2-diethyl-1,3-dioxocane-4,8-dione |
| SMILES | CCC1(CC)OC(=O)CCCC(=O)O1 |
| InChI | InChI=1S/C10H16O4/c1-3-10(4-2)13-8(11)6-5-7-9(12)14-10/h3-7H2,1-2H3 |
| InChIKey | BMGWSKOIJJGIIG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-diethyl-1,3-dioxocane-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1,3-dioxocane-4,8-dione?
The IUPAC name of 2,2-diethyl-1,3-dioxocane-4,8-dione (CID 70532987) is 2,2-diethyl-1,3-dioxocane-4,8-dione.
What is the SMILES notation for 2,2-diethyl-1,3-dioxocane-4,8-dione?
The canonical SMILES for 2,2-diethyl-1,3-dioxocane-4,8-dione is CCC1(CC)OC(=O)CCCC(=O)O1.
What is the InChIKey of 2,2-diethyl-1,3-dioxocane-4,8-dione?
The InChIKey is BMGWSKOIJJGIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-3-10(4-2)13-8(11)6-5-7-9(12)14-10/h3-7H2,1-2H3.
What are the key properties of 2,2-diethyl-1,3-dioxocane-4,8-dione?
2,2-diethyl-1,3-dioxocane-4,8-dione has a molecular weight of 200.23 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1,3-dioxocane-4,8-dione is sourced from PubChem (CID 70532987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).