About [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate
[4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate (PubChem CID 70533004) has the molecular formula C16H17F3N2O3
and a molecular weight of 342.32 g/mol. Its IUPAC name is [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate.
Molecular Properties
| Compound Name | [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate |
| PubChem CID | 70533004 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate |
| SMILES | CC(=O)OC(C(C)C(F)F)C(Oc1ccc(F)cc1)n1ccnc1 |
| InChI | InChI=1S/C16H17F3N2O3/c1-10(15(18)19)14(23-11(2)22)16(21-8-7-20-9-21)24-13-5-3-12(17)4-6-13/h3-10,14-16H,1-2H3 |
| InChIKey | XLJJEFRCDGDOAP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate?
The IUPAC name of [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate (CID 70533004) is [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate.
What is the SMILES notation for [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate?
The canonical SMILES for [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate is CC(=O)OC(C(C)C(F)F)C(Oc1ccc(F)cc1)n1ccnc1.
What is the InChIKey of [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate?
The InChIKey is XLJJEFRCDGDOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N2O3/c1-10(15(18)19)14(23-11(2)22)16(21-8-7-20-9-21)24-13-5-3-12(17)4-6-13/h3-10,14-16H,1-2H3.
What are the key properties of [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate?
[4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate has a molecular weight of 342.32 g/mol, XLogP of 3.43, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-1-(4-fluorophenoxy)-1-imidazol-1-yl-3-methylbutan-2-yl] acetate is sourced from PubChem (CID 70533004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).