C18H26ClN3O2 — CID 70533030
[C-[2-(4-methoxyphenyl)ethenyl]-N-(4-methylcyclohexyl)carbonimidoyl]urea;hydrochloride (PubChem CID 70533030) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is [C-[2-(4-methoxyphenyl)ethenyl]-N-(4-methylcyclohexyl)carbonimidoyl]urea;hydrochloride.
| Compound Name | [C-[2-(4-methoxyphenyl)ethenyl]-N-(4-methylcyclohexyl)carbonimidoyl]urea;hydrochloride |
|---|---|
| PubChem CID | 70533030 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [C-[2-(4-methoxyphenyl)ethenyl]-N-(4-methylcyclohexyl)carbonimidoyl]urea;hydrochloride |
| SMILES | COc1ccc(C=C/C(=N/C2CCC(C)CC2)NC(N)=O)cc1.Cl |
| InChI | InChI=1S/C18H25N3O2.ClH/c1-13-3-8-15(9-4-13)20-17(21-18(19)22)12-7-14-5-10-16(23-2)11-6-14;/h5-7,10-13,15H,3-4,8-9H2,1-2H3,(H3,19,20,21,22);1H |
| InChIKey | SXGXORBQCUGQFM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|