About (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol
(4-prop-2-enyl-1,3-dioxolan-4-yl)methanol (PubChem CID 70533157) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol.
Molecular Properties
| Compound Name | (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol |
| PubChem CID | 70533157 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol |
| SMILES | C=CCC1(CO)COCO1 |
| InChI | InChI=1S/C7H12O3/c1-2-3-7(4-8)5-9-6-10-7/h2,8H,1,3-6H2 |
| InChIKey | WLOWYQWPUOYUPX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol?
The IUPAC name of (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol (CID 70533157) is (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol.
What is the SMILES notation for (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol?
The canonical SMILES for (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol is C=CCC1(CO)COCO1.
What is the InChIKey of (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol?
The InChIKey is WLOWYQWPUOYUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-3-7(4-8)5-9-6-10-7/h2,8H,1,3-6H2.
What are the key properties of (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol?
(4-prop-2-enyl-1,3-dioxolan-4-yl)methanol has a molecular weight of 144.17 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-prop-2-enyl-1,3-dioxolan-4-yl)methanol is sourced from PubChem (CID 70533157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).