C21H22N3O3- — CID 7053322
2-[[(2S)-2-methyl-7-(3-oxobutyl)-1,2,3,4-tetrahydroquinolin-6-yl]diazenyl]benzoate (PubChem CID 7053322) has the molecular formula C21H22N3O3- and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[[(2S)-2-methyl-7-(3-oxobutyl)-1,2,3,4-tetrahydroquinolin-6-yl]diazenyl]benzoate.
| Compound Name | 2-[[(2S)-2-methyl-7-(3-oxobutyl)-1,2,3,4-tetrahydroquinolin-6-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 7053322 |
| Molecular Formula | C21H22N3O3- |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[[(2S)-2-methyl-7-(3-oxobutyl)-1,2,3,4-tetrahydroquinolin-6-yl]diazenyl]benzoate |
| SMILES | CC(=O)CCc1cc2c(cc1/N=N/c1ccccc1C(=O)[O-])CC[C@H](C)N2 |
| InChI | InChI=1S/C21H23N3O3/c1-13-7-9-15-12-20(16(10-8-14(2)25)11-19(15)22-13)24-23-18-6-4-3-5-17(18)21(26)27/h3-6,11-13,22H,7-10H2,1-2H3,(H,26,27)/p-1/b24-23+/t13-/m0/s1 |
| InChIKey | JZTCOJKNZPNJHD-LRNBNYQNSA-M |
| XLogP | 3.73 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|