About 1H-pyrazolo[4,5-h]isoquinoline
1H-pyrazolo[4,5-h]isoquinoline (PubChem CID 70533280) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 1H-pyrazolo[4,5-h]isoquinoline.
Molecular Properties
| Compound Name | 1H-pyrazolo[4,5-h]isoquinoline |
| PubChem CID | 70533280 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1H-pyrazolo[4,5-h]isoquinoline |
| SMILES | c1cc2ccc3cn[nH]c3c2cn1 |
| InChI | InChI=1S/C10H7N3/c1-2-8-5-12-13-10(8)9-6-11-4-3-7(1)9/h1-6H,(H,12,13) |
| InChIKey | PWFBLQFJGFAIQK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrazolo[4,5-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[4,5-h]isoquinoline?
The IUPAC name of 1H-pyrazolo[4,5-h]isoquinoline (CID 70533280) is 1H-pyrazolo[4,5-h]isoquinoline.
What is the SMILES notation for 1H-pyrazolo[4,5-h]isoquinoline?
The canonical SMILES for 1H-pyrazolo[4,5-h]isoquinoline is c1cc2ccc3cn[nH]c3c2cn1.
What is the InChIKey of 1H-pyrazolo[4,5-h]isoquinoline?
The InChIKey is PWFBLQFJGFAIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-8-5-12-13-10(8)9-6-11-4-3-7(1)9/h1-6H,(H,12,13).
What are the key properties of 1H-pyrazolo[4,5-h]isoquinoline?
1H-pyrazolo[4,5-h]isoquinoline has a molecular weight of 169.19 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[4,5-h]isoquinoline is sourced from PubChem (CID 70533280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).