C9H15NO — CID 70533405
1,2,3,4,4a,5,6,7-octahydroquinolin-6-ol (PubChem CID 70533405) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7-octahydroquinolin-6-ol.
| Compound Name | 1,2,3,4,4a,5,6,7-octahydroquinolin-6-ol |
|---|---|
| PubChem CID | 70533405 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1,2,3,4,4a,5,6,7-octahydroquinolin-6-ol |
| SMILES | OC1CC=C2NCCCC2C1 |
| InChI | InChI=1S/C9H15NO/c11-8-3-4-9-7(6-8)2-1-5-10-9/h4,7-8,10-11H,1-3,5-6H2 |
| InChIKey | WTHMRRHIMGAWLM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |