About 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid
2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid (PubChem CID 70534132) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid |
| PubChem CID | 70534132 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid |
| SMILES | O=C(O)CC1Nc2ccccc2N1O |
| InChI | InChI=1S/C9H10N2O3/c12-9(13)5-8-10-6-3-1-2-4-7(6)11(8)14/h1-4,8,10,14H,5H2,(H,12,13) |
| InChIKey | AFWGGCQJEDFFIJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid?
The IUPAC name of 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid (CID 70534132) is 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid.
What is the SMILES notation for 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid?
The canonical SMILES for 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid is O=C(O)CC1Nc2ccccc2N1O.
What is the InChIKey of 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid?
The InChIKey is AFWGGCQJEDFFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c12-9(13)5-8-10-6-3-1-2-4-7(6)11(8)14/h1-4,8,10,14H,5H2,(H,12,13).
What are the key properties of 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid?
2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid has a molecular weight of 194.19 g/mol, XLogP of 1.11, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-1,2-dihydrobenzimidazol-2-yl)acetic acid is sourced from PubChem (CID 70534132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).