C25H37N3O2 — CID 70534386
N-(6-octoxy-3-phenylpyridazin-4-yl)heptanamide (PubChem CID 70534386) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-(6-octoxy-3-phenylpyridazin-4-yl)heptanamide.
| Compound Name | N-(6-octoxy-3-phenylpyridazin-4-yl)heptanamide |
|---|---|
| PubChem CID | 70534386 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N-(6-octoxy-3-phenylpyridazin-4-yl)heptanamide |
| SMILES | CCCCCCCCOc1cc(NC(=O)CCCCCC)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C25H37N3O2/c1-3-5-7-9-10-15-19-30-24-20-22(26-23(29)18-14-8-6-4-2)25(28-27-24)21-16-12-11-13-17-21/h11-13,16-17,20H,3-10,14-15,18-19H2,1-2H3,(H,26,27,29) |
| InChIKey | DQPVMUQDFFBLBW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|