About (2-ethoxyquinolin-3-yl) hydrogen carbonate
(2-ethoxyquinolin-3-yl) hydrogen carbonate (PubChem CID 70534566) has the molecular formula C12H11NO4
and a molecular weight of 233.22 g/mol. Its IUPAC name is (2-ethoxyquinolin-3-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-ethoxyquinolin-3-yl) hydrogen carbonate |
| PubChem CID | 70534566 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2-ethoxyquinolin-3-yl) hydrogen carbonate |
| SMILES | CCOc1nc2ccccc2cc1OC(=O)O |
| InChI | InChI=1S/C12H11NO4/c1-2-16-11-10(17-12(14)15)7-8-5-3-4-6-9(8)13-11/h3-7H,2H2,1H3,(H,14,15) |
| InChIKey | SWKFCQLQFSPGOE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethoxyquinolin-3-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxyquinolin-3-yl) hydrogen carbonate?
The IUPAC name of (2-ethoxyquinolin-3-yl) hydrogen carbonate (CID 70534566) is (2-ethoxyquinolin-3-yl) hydrogen carbonate.
What is the SMILES notation for (2-ethoxyquinolin-3-yl) hydrogen carbonate?
The canonical SMILES for (2-ethoxyquinolin-3-yl) hydrogen carbonate is CCOc1nc2ccccc2cc1OC(=O)O.
What is the InChIKey of (2-ethoxyquinolin-3-yl) hydrogen carbonate?
The InChIKey is SWKFCQLQFSPGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-2-16-11-10(17-12(14)15)7-8-5-3-4-6-9(8)13-11/h3-7H,2H2,1H3,(H,14,15).
What are the key properties of (2-ethoxyquinolin-3-yl) hydrogen carbonate?
(2-ethoxyquinolin-3-yl) hydrogen carbonate has a molecular weight of 233.22 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyquinolin-3-yl) hydrogen carbonate is sourced from PubChem (CID 70534566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).