C18H30O5 — CID 70535302
1-[(1'R,2'R,3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-8-hydroxyoctan-3-one (PubChem CID 70535302) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-[(1'R,2'R,3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-8-hydroxyoctan-3-one.
| Compound Name | 1-[(1'R,2'R,3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-8-hydroxyoctan-3-one |
|---|---|
| PubChem CID | 70535302 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[(1'R,2'R,3'aS,6'aR)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-8-hydroxyoctan-3-one |
| SMILES | O=C(CCCCCO)CC[C@@H]1[C@@H]2CC3(C[C@@H]2C[C@H]1O)OCCO3 |
| InChI | InChI=1S/C18H30O5/c19-7-3-1-2-4-14(20)5-6-15-16-12-18(22-8-9-23-18)11-13(16)10-17(15)21/h13,15-17,19,21H,1-12H2/t13-,15+,16+,17+/m0/s1 |
| InChIKey | LSZCMFQQXBPLEY-RKTXRCNFSA-N |
| XLogP | 2.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|