C17H20N4O2 — CID 70536326
(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5,9-dicarboxamide (PubChem CID 70536326) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5,9-dicarboxamide.
| Compound Name | (6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5,9-dicarboxamide |
|---|---|
| PubChem CID | 70536326 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5,9-dicarboxamide |
| SMILES | CN1CC(C(N)=O)C[C@@H]2c3cccc4[nH]c(C(N)=O)c(c34)C[C@H]21 |
| InChI | InChI=1S/C17H20N4O2/c1-21-7-8(16(18)22)5-10-9-3-2-4-12-14(9)11(6-13(10)21)15(20-12)17(19)23/h2-4,8,10,13,20H,5-7H2,1H3,(H2,18,22)(H2,19,23)/t8?,10-,13-/m1/s1 |
| InChIKey | FKHMUZMUEHGUGW-KHQYTQLFSA-N |
| XLogP | 0.71 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |