About 1-(1,2,4-triazol-1-yl)heptan-3-ol
1-(1,2,4-triazol-1-yl)heptan-3-ol (PubChem CID 70536487) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(1,2,4-triazol-1-yl)heptan-3-ol.
Molecular Properties
| Compound Name | 1-(1,2,4-triazol-1-yl)heptan-3-ol |
| PubChem CID | 70536487 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(1,2,4-triazol-1-yl)heptan-3-ol |
| SMILES | CCCCC(O)CCn1cncn1 |
| InChI | InChI=1S/C9H17N3O/c1-2-3-4-9(13)5-6-12-8-10-7-11-12/h7-9,13H,2-6H2,1H3 |
| InChIKey | HJQZBGWIEQMGNO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2,4-triazol-1-yl)heptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-triazol-1-yl)heptan-3-ol?
The IUPAC name of 1-(1,2,4-triazol-1-yl)heptan-3-ol (CID 70536487) is 1-(1,2,4-triazol-1-yl)heptan-3-ol.
What is the SMILES notation for 1-(1,2,4-triazol-1-yl)heptan-3-ol?
The canonical SMILES for 1-(1,2,4-triazol-1-yl)heptan-3-ol is CCCCC(O)CCn1cncn1.
What is the InChIKey of 1-(1,2,4-triazol-1-yl)heptan-3-ol?
The InChIKey is HJQZBGWIEQMGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-2-3-4-9(13)5-6-12-8-10-7-11-12/h7-9,13H,2-6H2,1H3.
What are the key properties of 1-(1,2,4-triazol-1-yl)heptan-3-ol?
1-(1,2,4-triazol-1-yl)heptan-3-ol has a molecular weight of 183.25 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-triazol-1-yl)heptan-3-ol is sourced from PubChem (CID 70536487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).