C8H11Cl2F3 — CID 70536698
2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1-dimethylcyclopropane (PubChem CID 70536698) has the molecular formula C8H11Cl2F3 and a molecular weight of 235.08 g/mol. Its IUPAC name is 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1-dimethylcyclopropane.
| Compound Name | 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 70536698 |
| Molecular Formula | C8H11Cl2F3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-(2,2-dichloro-3,3,3-trifluoropropyl)-1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C8H11Cl2F3/c1-6(2)3-5(6)4-7(9,10)8(11,12)13/h5H,3-4H2,1-2H3 |
| InChIKey | WEBMLUOXWHPWCK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|