C10H7NO4 — CID 7053675
methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate (PubChem CID 7053675) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate.
| Compound Name | methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate |
|---|---|
| PubChem CID | 7053675 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate |
| SMILES | COC(=O)[C@]12ON1c1ccccc1C2=O |
| InChI | InChI=1S/C10H7NO4/c1-14-9(13)10-8(12)6-4-2-3-5-7(6)11(10)15-10/h2-5H,1H3/t10-,11?/m0/s1 |
| InChIKey | IDUZWGCAKFWEHI-VUWPPUDQSA-N |
| XLogP | 0.50 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|