methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate

C10H7NO4 — CID 7053675

IUPACmethyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate
SMILESCOC(=O)[C@]12ON1c1ccccc1C2=O
InChIInChI=1S/C10H7NO4/c1-14-9(13)10-8(12)6-4-2-3-5-7(6)11(10)15-10/h2-5H,1H3/t10-,11?/m0/s1
InChIKeyIDUZWGCAKFWEHI-VUWPPUDQSA-N
MW205.17 g/mol
LogP0.50
Rot. Bonds1

About methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate

methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate (PubChem CID 7053675) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate.

Molecular Properties

Compound Namemethyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate
PubChem CID7053675
Molecular FormulaC10H7NO4
Molecular Weight205.17 g/mol
Exact Mass205.04
IUPAC Namemethyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate
SMILESCOC(=O)[C@]12ON1c1ccccc1C2=O
InChIInChI=1S/C10H7NO4/c1-14-9(13)10-8(12)6-4-2-3-5-7(6)11(10)15-10/h2-5H,1H3/t10-,11?/m0/s1
InChIKeyIDUZWGCAKFWEHI-VUWPPUDQSA-N
XLogP0.50
TPSA58.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.17
LogP ≤ 50.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate?
The IUPAC name of methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate (CID 7053675) is methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate.
What is the SMILES notation for methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate?
The canonical SMILES for methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate is COC(=O)[C@]12ON1c1ccccc1C2=O.
What is the InChIKey of methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate?
The InChIKey is IDUZWGCAKFWEHI-VUWPPUDQSA-N. The full InChI is InChI=1S/C10H7NO4/c1-14-9(13)10-8(12)6-4-2-3-5-7(6)11(10)15-10/h2-5H,1H3/t10-,11?/m0/s1.
What are the key properties of methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate?
methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate has a molecular weight of 205.17 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (7aS)-7-oxooxazireno[2,3-a]indole-7a-carboxylate is sourced from PubChem (CID 7053675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).