About (3R)-3,7-dimethyloct-7-en-1-ol
(3R)-3,7-dimethyloct-7-en-1-ol (PubChem CID 7053730) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is (3R)-3,7-dimethyloct-7-en-1-ol.
Molecular Properties
| Compound Name | (3R)-3,7-dimethyloct-7-en-1-ol |
| PubChem CID | 7053730 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (3R)-3,7-dimethyloct-7-en-1-ol |
| SMILES | C=C(C)CCC[C@@H](C)CCO |
| InChI | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h10-11H,1,4-8H2,2-3H3/t10-/m1/s1 |
| InChIKey | JGQFVRIQXUFPAH-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,7-dimethyloct-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,7-dimethyloct-7-en-1-ol?
The IUPAC name of (3R)-3,7-dimethyloct-7-en-1-ol (CID 7053730) is (3R)-3,7-dimethyloct-7-en-1-ol.
What is the SMILES notation for (3R)-3,7-dimethyloct-7-en-1-ol?
The canonical SMILES for (3R)-3,7-dimethyloct-7-en-1-ol is C=C(C)CCC[C@@H](C)CCO.
What is the InChIKey of (3R)-3,7-dimethyloct-7-en-1-ol?
The InChIKey is JGQFVRIQXUFPAH-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h10-11H,1,4-8H2,2-3H3/t10-/m1/s1.
What are the key properties of (3R)-3,7-dimethyloct-7-en-1-ol?
(3R)-3,7-dimethyloct-7-en-1-ol has a molecular weight of 156.27 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,7-dimethyloct-7-en-1-ol is sourced from PubChem (CID 7053730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).