C13H10N2S — CID 70537485
14-thia-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11(15)-hexaene (PubChem CID 70537485) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 14-thia-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11(15)-hexaene.
| Compound Name | 14-thia-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11(15)-hexaene |
|---|---|
| PubChem CID | 70537485 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 14-thia-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11(15)-hexaene |
| SMILES | C1=Nc2c3c(ccc2=C1)=NC1=C(C3)SCC1 |
| InChI | InChI=1S/C13H10N2S/c1-2-10-9(13-8(1)3-5-14-13)7-12-11(15-10)4-6-16-12/h1-3,5H,4,6-7H2 |
| InChIKey | WJVXUNJOKMYPRJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |