C20H7ClI4O5 — CID 70537733
1'-chloro-3',6'-dihydroxy-4,5,6,7-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 70537733) has the molecular formula C20H7ClI4O5 and a molecular weight of 870.34 g/mol. Its IUPAC name is 1'-chloro-3',6'-dihydroxy-4,5,6,7-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1'-chloro-3',6'-dihydroxy-4,5,6,7-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 70537733 |
| Molecular Formula | C20H7ClI4O5 |
| Molecular Weight | 870.34 g/mol |
| Exact Mass | 869.62 |
| IUPAC Name | 1'-chloro-3',6'-dihydroxy-4,5,6,7-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)cc(Cl)c32)c2c(I)c(I)c(I)c(I)c21 |
| InChI | InChI=1S/C20H7ClI4O5/c21-9-3-7(27)5-11-13(9)20(8-2-1-6(26)4-10(8)29-11)14-12(19(28)30-20)15(22)17(24)18(25)16(14)23/h1-5,26-27H |
| InChIKey | WGLUCGLFFIGFRV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.34 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|