C20H29NO — CID 70538112
(3Z)-3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;N,N-dimethylmethanamine (PubChem CID 70538112) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (3Z)-3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;N,N-dimethylmethanamine.
| Compound Name | (3Z)-3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 70538112 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (3Z)-3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;N,N-dimethylmethanamine |
| SMILES | CC12CCC(/C(=C/c3ccccc3)C1=O)C2(C)C.CN(C)C |
| InChI | InChI=1S/C17H20O.C3H9N/c1-16(2)14-9-10-17(16,3)15(18)13(14)11-12-7-5-4-6-8-12;1-4(2)3/h4-8,11,14H,9-10H2,1-3H3;1-3H3/b13-11-; |
| InChIKey | UVWUGIIVPCMBJH-KEHAOADBSA-N |
| XLogP | 4.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|