C20H38N4O5Si2 — CID 70538226
3-[3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methyl-trimethylsilyloxysilyl]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 70538226) has the molecular formula C20H38N4O5Si2 and a molecular weight of 470.72 g/mol. Its IUPAC name is 3-[3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methyl-trimethylsilyloxysilyl]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methyl-trimethylsilyloxysilyl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70538226 |
| Molecular Formula | C20H38N4O5Si2 |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 3-[3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-methyl-trimethylsilyloxysilyl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCC[Si](C)(CCCN2C(=O)NC(C)(C)C2=O)O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C20H38N4O5Si2/c1-19(2)15(25)23(17(27)21-19)11-9-13-31(8,29-30(5,6)7)14-10-12-24-16(26)20(3,4)22-18(24)28/h9-14H2,1-8H3,(H,21,27)(H,22,28) |
| InChIKey | LUFGFQANBPBXEC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|