C28H51NO4 — CID 70538321
1,1-diethoxyethane;ethene;(5S,8R,9S,10S,13S,14S,16S,17S)-16-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70538321) has the molecular formula C28H51NO4 and a molecular weight of 465.72 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;(5S,8R,9S,10S,13S,14S,16S,17S)-16-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 1,1-diethoxyethane;ethene;(5S,8R,9S,10S,13S,14S,16S,17S)-16-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70538321 |
| Molecular Formula | C28H51NO4 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.38 |
| IUPAC Name | 1,1-diethoxyethane;ethene;(5S,8R,9S,10S,13S,14S,16S,17S)-16-hydroxy-10,13-dimethyl-17-(methylamino)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C.CCOC(C)OCC.CN[C@@H]1[C@@H](O)C[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H33NO2.C6H14O2.C2H4/c1-19-8-6-13(22)10-12(19)4-5-14-15(19)7-9-20(2)16(14)11-17(23)18(20)21-3;1-4-7-6(3)8-5-2;1-2/h12,14-18,21,23H,4-11H2,1-3H3;6H,4-5H2,1-3H3;1-2H2/t12-,14+,15-,16-,17-,18+,19-,20-;;/m0../s1 |
| InChIKey | PQVCPKJOXMWPRU-SUOIDTTPSA-N |
| XLogP | 5.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|