About 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine
3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine (PubChem CID 70538404) has the molecular formula C16H39N7
and a molecular weight of 329.54 g/mol. Its IUPAC name is 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine.
Molecular Properties
| Compound Name | 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine |
| PubChem CID | 70538404 |
| Molecular Formula | C16H39N7 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine |
| SMILES | NCCCC1CNCCN1CCCN.NCCN1CCNCC1 |
| InChI | InChI=1S/C10H24N4.C6H15N3/c11-4-1-3-10-9-13-6-8-14(10)7-2-5-12;7-1-4-9-5-2-8-3-6-9/h10,13H,1-9,11-12H2;8H,1-7H2 |
| InChIKey | QYIBXAFQIGYXBO-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine?
The IUPAC name of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine (CID 70538404) is 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine.
What is the SMILES notation for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine?
The canonical SMILES for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine is NCCCC1CNCCN1CCCN.NCCN1CCNCC1.
What is the InChIKey of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine?
The InChIKey is QYIBXAFQIGYXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N4.C6H15N3/c11-4-1-3-10-9-13-6-8-14(10)7-2-5-12;7-1-4-9-5-2-8-3-6-9/h10,13H,1-9,11-12H2;8H,1-7H2.
What are the key properties of 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine?
3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine has a molecular weight of 329.54 g/mol, XLogP of -1.80, 8 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-aminopropyl)piperazin-2-yl]propan-1-amine;2-piperazin-1-ylethanamine is sourced from PubChem (CID 70538404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).