About 4,4a-dihydropyrido[3,4-b]pyrazine
4,4a-dihydropyrido[3,4-b]pyrazine (PubChem CID 70538561) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4,4a-dihydropyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 4,4a-dihydropyrido[3,4-b]pyrazine |
| PubChem CID | 70538561 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4,4a-dihydropyrido[3,4-b]pyrazine |
| SMILES | C1=CC2=NC=CNC2C=N1 |
| InChI | InChI=1S/C7H7N3/c1-2-8-5-7-6(1)9-3-4-10-7/h1-5,7,10H |
| InChIKey | PWWQQEAUEMUERI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4a-dihydropyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a-dihydropyrido[3,4-b]pyrazine?
The IUPAC name of 4,4a-dihydropyrido[3,4-b]pyrazine (CID 70538561) is 4,4a-dihydropyrido[3,4-b]pyrazine.
What is the SMILES notation for 4,4a-dihydropyrido[3,4-b]pyrazine?
The canonical SMILES for 4,4a-dihydropyrido[3,4-b]pyrazine is C1=CC2=NC=CNC2C=N1.
What is the InChIKey of 4,4a-dihydropyrido[3,4-b]pyrazine?
The InChIKey is PWWQQEAUEMUERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-2-8-5-7-6(1)9-3-4-10-7/h1-5,7,10H.
What are the key properties of 4,4a-dihydropyrido[3,4-b]pyrazine?
4,4a-dihydropyrido[3,4-b]pyrazine has a molecular weight of 133.15 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a-dihydropyrido[3,4-b]pyrazine is sourced from PubChem (CID 70538561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).