C20H18N4O2 — CID 70538956
3,3-dimethyl-1-(4-phenylphenyl)-5-(1,2,4-triazol-1-yl)pyrrolidine-2,4-dione (PubChem CID 70538956) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-phenylphenyl)-5-(1,2,4-triazol-1-yl)pyrrolidine-2,4-dione.
| Compound Name | 3,3-dimethyl-1-(4-phenylphenyl)-5-(1,2,4-triazol-1-yl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 70538956 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3,3-dimethyl-1-(4-phenylphenyl)-5-(1,2,4-triazol-1-yl)pyrrolidine-2,4-dione |
| SMILES | CC1(C)C(=O)C(n2cncn2)N(c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H18N4O2/c1-20(2)17(25)18(23-13-21-12-22-23)24(19(20)26)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-13,18H,1-2H3 |
| InChIKey | CYLCRJNBJYNUTI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|