C12H11Cl2N3O — CID 70539608
1-[(Z)-2-(2,4-dichlorophenyl)-2-ethoxyethenyl]-1,2,4-triazole (PubChem CID 70539608) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is 1-[(Z)-2-(2,4-dichlorophenyl)-2-ethoxyethenyl]-1,2,4-triazole.
| Compound Name | 1-[(Z)-2-(2,4-dichlorophenyl)-2-ethoxyethenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70539608 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 1-[(Z)-2-(2,4-dichlorophenyl)-2-ethoxyethenyl]-1,2,4-triazole |
| SMILES | CCO/C(=C\n1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O/c1-2-18-12(6-17-8-15-7-16-17)10-4-3-9(13)5-11(10)14/h3-8H,2H2,1H3/b12-6- |
| InChIKey | LPHNCSSRNIUADC-SDQBBNPISA-N |
| XLogP | 3.58 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|