C13H22F3N3O3 — CID 70539748
(2S)-1-[(2R)-2,6-diamino-2-(2,2,2-trifluoroethyl)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70539748) has the molecular formula C13H22F3N3O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is (2S)-1-[(2R)-2,6-diamino-2-(2,2,2-trifluoroethyl)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2R)-2,6-diamino-2-(2,2,2-trifluoroethyl)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70539748 |
| Molecular Formula | C13H22F3N3O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-1-[(2R)-2,6-diamino-2-(2,2,2-trifluoroethyl)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@@](N)(CC(F)(F)F)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H22F3N3O3/c14-13(15,16)8-12(18,5-1-2-6-17)11(22)19-7-3-4-9(19)10(20)21/h9H,1-8,17-18H2,(H,20,21)/t9-,12+/m0/s1 |
| InChIKey | WFIPNEJDKHSXIM-JOYOIKCWSA-N |
| XLogP | 0.84 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|