About (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one
(3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one (PubChem CID 70539958) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one.
Molecular Properties
| Compound Name | (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one |
| PubChem CID | 70539958 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one |
| SMILES | CC(C)(C)[C@@H]1CCC(=O)C1(C)C |
| InChI | InChI=1S/C11H20O/c1-10(2,3)8-6-7-9(12)11(8,4)5/h8H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | BGYNLSJCVDDFPZ-QMMMGPOBSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one?
The IUPAC name of (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one (CID 70539958) is (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one.
What is the SMILES notation for (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one?
The canonical SMILES for (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one is CC(C)(C)[C@@H]1CCC(=O)C1(C)C.
What is the InChIKey of (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one?
The InChIKey is BGYNLSJCVDDFPZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H20O/c1-10(2,3)8-6-7-9(12)11(8,4)5/h8H,6-7H2,1-5H3/t8-/m0/s1.
What are the key properties of (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one?
(3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one has a molecular weight of 168.28 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-tert-butyl-2,2-dimethylcyclopentan-1-one is sourced from PubChem (CID 70539958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).