About 2-propyl-1H-pyrrol-3-ol
2-propyl-1H-pyrrol-3-ol (PubChem CID 70540256) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-propyl-1H-pyrrol-3-ol.
Molecular Properties
| Compound Name | 2-propyl-1H-pyrrol-3-ol |
| PubChem CID | 70540256 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-propyl-1H-pyrrol-3-ol |
| SMILES | CCCc1[nH]ccc1O |
| InChI | InChI=1S/C7H11NO/c1-2-3-6-7(9)4-5-8-6/h4-5,8-9H,2-3H2,1H3 |
| InChIKey | KQINTHGGORCERL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propyl-1H-pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1H-pyrrol-3-ol?
The IUPAC name of 2-propyl-1H-pyrrol-3-ol (CID 70540256) is 2-propyl-1H-pyrrol-3-ol.
What is the SMILES notation for 2-propyl-1H-pyrrol-3-ol?
The canonical SMILES for 2-propyl-1H-pyrrol-3-ol is CCCc1[nH]ccc1O.
What is the InChIKey of 2-propyl-1H-pyrrol-3-ol?
The InChIKey is KQINTHGGORCERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-3-6-7(9)4-5-8-6/h4-5,8-9H,2-3H2,1H3.
What are the key properties of 2-propyl-1H-pyrrol-3-ol?
2-propyl-1H-pyrrol-3-ol has a molecular weight of 125.17 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1H-pyrrol-3-ol is sourced from PubChem (CID 70540256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).