C17H29N — CID 70540920
3,3-dipropyl-1-azacyclododeca-1,5,9-triene (PubChem CID 70540920) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 3,3-dipropyl-1-azacyclododeca-1,5,9-triene.
| Compound Name | 3,3-dipropyl-1-azacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 70540920 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 3,3-dipropyl-1-azacyclododeca-1,5,9-triene |
| SMILES | CCCC1(CCC)/C=N/CCC=CCCC=CC1 |
| InChI | InChI=1S/C17H29N/c1-3-12-17(13-4-2)14-10-8-6-5-7-9-11-15-18-16-17/h7-10,16H,3-6,11-15H2,1-2H3/b9-7?,10-8?,18-16+ |
| InChIKey | WETVROIRBVILGG-RXFYXMRISA-N |
| XLogP | 5.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|