About 2,3-dihydropyrazine-2,3-dicarbonitrile
2,3-dihydropyrazine-2,3-dicarbonitrile (PubChem CID 70541357) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is 2,3-dihydropyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2,3-dihydropyrazine-2,3-dicarbonitrile |
| PubChem CID | 70541357 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2,3-dihydropyrazine-2,3-dicarbonitrile |
| SMILES | N#CC1N=CC=NC1C#N |
| InChI | InChI=1S/C6H4N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2,5-6H |
| InChIKey | ASQJSSKHMAMBLG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydropyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyrazine-2,3-dicarbonitrile?
The IUPAC name of 2,3-dihydropyrazine-2,3-dicarbonitrile (CID 70541357) is 2,3-dihydropyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 2,3-dihydropyrazine-2,3-dicarbonitrile?
The canonical SMILES for 2,3-dihydropyrazine-2,3-dicarbonitrile is N#CC1N=CC=NC1C#N.
What is the InChIKey of 2,3-dihydropyrazine-2,3-dicarbonitrile?
The InChIKey is ASQJSSKHMAMBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2,5-6H.
What are the key properties of 2,3-dihydropyrazine-2,3-dicarbonitrile?
2,3-dihydropyrazine-2,3-dicarbonitrile has a molecular weight of 132.13 g/mol, XLogP of -0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 70541357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).