C17H23O4- — CID 7054138
trans-(1R,3S)-3-[(1S,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylate (PubChem CID 7054138) has the molecular formula C17H23O4- and a molecular weight of 291.37 g/mol. Its IUPAC name is trans-(1R,3S)-3-[(1S,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylate.
| Compound Name | trans-(1R,3S)-3-[(1S,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7054138 |
| Molecular Formula | C17H23O4- |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | trans-(1R,3S)-3-[(1S,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylate |
| SMILES | CC1(C)[C@@H]([C@H](O)[C@H](O)c2ccccc2)CC[C@@]1(C)C(=O)[O-] |
| InChI | InChI=1S/C17H24O4/c1-16(2)12(9-10-17(16,3)15(20)21)14(19)13(18)11-7-5-4-6-8-11/h4-8,12-14,18-19H,9-10H2,1-3H3,(H,20,21)/p-1/t12-,13-,14+,17+/m1/s1 |
| InChIKey | DIDBNOMHOXVHIY-WVZRYYJFSA-M |
| XLogP | 1.27 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |