About 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine
5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine (PubChem CID 705419) has the molecular formula C12H11F3N2
and a molecular weight of 240.23 g/mol. Its IUPAC name is 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine |
| PubChem CID | 705419 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine |
| SMILES | FC(F)(F)C1=CC(c2ccccc2)=NCCN1 |
| InChI | InChI=1S/C12H11F3N2/c13-12(14,15)11-8-10(16-6-7-17-11)9-4-2-1-3-5-9/h1-5,8,17H,6-7H2 |
| InChIKey | MTGUYKMVEUMQQY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The IUPAC name of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine (CID 705419) is 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine.
What is the SMILES notation for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The canonical SMILES for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine is FC(F)(F)C1=CC(c2ccccc2)=NCCN1.
What is the InChIKey of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The InChIKey is MTGUYKMVEUMQQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2/c13-12(14,15)11-8-10(16-6-7-17-11)9-4-2-1-3-5-9/h1-5,8,17H,6-7H2.
What are the key properties of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine has a molecular weight of 240.23 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1H-1,4-diazepine is sourced from PubChem (CID 705419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).