About [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid
[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid (PubChem CID 70542154) has the molecular formula C23H27NO3
and a molecular weight of 365.47 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid.
Molecular Properties
| Compound Name | [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid |
| PubChem CID | 70542154 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid |
| SMILES | CC(C)=CC1C(N(Cc2cccc(Oc3ccccc3)c2)C(=O)O)C1(C)C |
| InChI | InChI=1S/C23H27NO3/c1-16(2)13-20-21(23(20,3)4)24(22(25)26)15-17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-21H,15H2,1-4H3,(H,25,26) |
| InChIKey | HYNCMRAHAXPELS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid?
The IUPAC name of [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid (CID 70542154) is [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid.
What is the SMILES notation for [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid?
The canonical SMILES for [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid is CC(C)=CC1C(N(Cc2cccc(Oc3ccccc3)c2)C(=O)O)C1(C)C.
What is the InChIKey of [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid?
The InChIKey is HYNCMRAHAXPELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO3/c1-16(2)13-20-21(23(20,3)4)24(22(25)26)15-17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-21H,15H2,1-4H3,(H,25,26).
What are the key properties of [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid?
[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid has a molecular weight of 365.47 g/mol, XLogP of 5.95, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]-[(3-phenoxyphenyl)methyl]carbamic acid is sourced from PubChem (CID 70542154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).