C15H11N3S2 — CID 705423
1-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazole (PubChem CID 705423) has the molecular formula C15H11N3S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazole.
| Compound Name | 1-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 705423 |
| Molecular Formula | C15H11N3S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 1-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
| SMILES | c1ccc(CSc2nnc3sc4ccccc4n23)cc1 |
| InChI | InChI=1S/C15H11N3S2/c1-2-6-11(7-3-1)10-19-14-16-17-15-18(14)12-8-4-5-9-13(12)20-15/h1-9H,10H2 |
| InChIKey | HPIWWGFHNDQKLM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |