C11H21N — CID 70542347
2-methyl-4-pentyl-1,2,3,6-tetrahydropyridine (PubChem CID 70542347) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-methyl-4-pentyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-methyl-4-pentyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 70542347 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-methyl-4-pentyl-1,2,3,6-tetrahydropyridine |
| SMILES | CCCCCC1=CCNC(C)C1 |
| InChI | InChI=1S/C11H21N/c1-3-4-5-6-11-7-8-12-10(2)9-11/h7,10,12H,3-6,8-9H2,1-2H3 |
| InChIKey | QGXHILOFRLCISD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|