C11H17BrO8 — CID 70542371
(4S,5S)-5-[(4R,5S)-2-(bromomethyl)-5-hydroxy-1,3-dioxan-4-yl]-4-hydroxy-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 70542371) has the molecular formula C11H17BrO8 and a molecular weight of 357.15 g/mol. Its IUPAC name is (4S,5S)-5-[(4R,5S)-2-(bromomethyl)-5-hydroxy-1,3-dioxan-4-yl]-4-hydroxy-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5S)-5-[(4R,5S)-2-(bromomethyl)-5-hydroxy-1,3-dioxan-4-yl]-4-hydroxy-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 70542371 |
| Molecular Formula | C11H17BrO8 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (4S,5S)-5-[(4R,5S)-2-(bromomethyl)-5-hydroxy-1,3-dioxan-4-yl]-4-hydroxy-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H]([C@@H]2OC(CBr)OC[C@@H]2O)[C@@](O)(C(=O)O)O1 |
| InChI | InChI=1S/C11H17BrO8/c1-10(2)19-8(11(16,20-10)9(14)15)7-5(13)4-17-6(3-12)18-7/h5-8,13,16H,3-4H2,1-2H3,(H,14,15)/t5-,6?,7+,8-,11-/m0/s1 |
| InChIKey | WWZVWBFLGOXCCS-CVEIEZJDSA-N |
| XLogP | -0.59 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|