C16H19NO4 — CID 70542435
bis(prop-2-enyl) 5,6,7,8-tetrahydroindolizine-1,8-dicarboxylate (PubChem CID 70542435) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is bis(prop-2-enyl) 5,6,7,8-tetrahydroindolizine-1,8-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 5,6,7,8-tetrahydroindolizine-1,8-dicarboxylate |
|---|---|
| PubChem CID | 70542435 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | bis(prop-2-enyl) 5,6,7,8-tetrahydroindolizine-1,8-dicarboxylate |
| SMILES | C=CCOC(=O)c1ccn2c1C(C(=O)OCC=C)CCC2 |
| InChI | InChI=1S/C16H19NO4/c1-3-10-20-15(18)12-6-5-8-17-9-7-13(14(12)17)16(19)21-11-4-2/h3-4,7,9,12H,1-2,5-6,8,10-11H2 |
| InChIKey | CRUHYSBXSHRWNH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|