C21H37NO2 — CID 7054255
cis-(1R,3S)-N,1,2,2,3-pentamethyl-N-[(1R,3R)-1,2,2,3-tetramethylcyclopentanecarbonyl]cyclopentane-1-carboxamide (PubChem CID 7054255) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is cis-(1R,3S)-N,1,2,2,3-pentamethyl-N-[(1R,3R)-1,2,2,3-tetramethylcyclopentanecarbonyl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N,1,2,2,3-pentamethyl-N-[(1R,3R)-1,2,2,3-tetramethylcyclopentanecarbonyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 7054255 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | cis-(1R,3S)-N,1,2,2,3-pentamethyl-N-[(1R,3R)-1,2,2,3-tetramethylcyclopentanecarbonyl]cyclopentane-1-carboxamide |
| SMILES | C[C@@H]1CC[C@@](C)(C(=O)N(C)C(=O)[C@]2(C)CC[C@H](C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C21H37NO2/c1-14-10-12-20(7,18(14,3)4)16(23)22(9)17(24)21(8)13-11-15(2)19(21,5)6/h14-15H,10-13H2,1-9H3/t14-,15+,20-,21-/m0/s1 |
| InChIKey | BHUKNCSDHSSDAL-YQMDMEMYSA-N |
| XLogP | 4.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|